| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:06 UTC |
|---|
| Update Date | 2025-03-25 00:54:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206047 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H9F3N2O2 |
|---|
| Molecular Mass | 198.0616 |
|---|
| SMILES | NC(=O)N1CCC(O)(C(F)(F)F)C1 |
|---|
| InChI Key | JIXAATULUUVNHA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrrolidines |
|---|
| Subclass | pyrrolidine carboxylic acids and derivatives |
|---|
| Direct Parent | pyrrolidinecarboxamides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesazacyclic compoundscarbonyl compoundsfluorohydrinshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundstertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarbonic acid derivativeazacyclehalohydrinalkyl fluorideorganofluoridefluorohydrinorganohalogen compoundtertiary alcoholorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundalkyl halidehydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundpyrrolidine-1-carboxamide |
|---|
