| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:08 UTC |
|---|
| Update Date | 2025-03-25 00:54:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206113 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H23N3O3 |
|---|
| Molecular Mass | 293.1739 |
|---|
| SMILES | NC(=O)c1ccccc1N1CCN(CCOCCO)CC1 |
|---|
| InChI Key | IIVHSCICJVUUAV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-aminobenzamidesalcohols and polyolsamino acids and derivativesaniline and substituted anilinesanthranilamidesazacyclic compoundsbenzoyl derivativescarboxylic acids and derivativesdialkyl ethersdialkylarylamineshydrocarbon derivativesn-alkylpiperazinesn-arylpiperazinesorganic oxidesorganopnictogen compoundsprimary carboxylic acid amidestrialkylaminesvinylogous amides |
|---|
| Substituents | primary carboxylic acid amidemonocyclic benzene moietyetheraromatic heteromonocyclic compoundamino acid or derivatives2-aminobenzamidebenzoylcarboxylic acid derivativedialkyl etherbenzamideorganic oxidetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylamineaminobenzoic acid or derivativestertiary aminealcoholvinylogous amideazacycleaniline or substituted anilinesn-alkylpiperazinetertiary aliphatic aminebenzoic acid or derivativescarboxamide groupaminobenzamidephenylpiperazineorganic oxygen compoundanthranilamidehydrocarbon derivativebenzenoidorganic nitrogen compoundaminen-arylpiperazineorganooxygen compound |
|---|
