DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 15:02:10 UTC
Update Date	2025-03-25 00:54:25 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID02206170
Frequency	0.5
Structure
Chemical Formula	C₁₆H₂₀N₂O₇S₂
Molecular Mass	416.0712
SMILES	NC(CCSSc1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1)C(=O)O
InChI Key	DSYOPAQAZQFUFD-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	carboxylic acids and derivatives
Subclass	amino acids, peptides, and analogues
Direct Parent	glutamic acid and derivatives
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	alpha amino acids benzoyl derivatives carbonyl compounds carboxylic acids fatty acyls hippuric acids and derivatives hydrocarbon derivatives monoalkylamines n-acyl-alpha amino acids organic disulfides organic oxides organonitrogen compounds organopnictogen compounds p-sulfanylbenzoic acids and derivatives secondary carboxylic acid amides sulfenyl compounds thia fatty acids tricarboxylic acids and derivatives
Substituents	fatty acyl monocyclic benzene moiety carbonyl group carboxylic acid benzoyl tricarboxylic acid or derivatives organosulfur compound benzamide organic oxide organonitrogen compound alpha-amino acid organopnictogen compound n-acyl-alpha amino acid or derivatives sulfenyl compound n-acyl-alpha-amino acid hippuric acid or derivatives benzoic acid or derivatives glutamic acid or derivatives carboxamide group aromatic homomonocyclic compound secondary carboxylic acid amide thia fatty acid organic oxygen compound p-sulfanylbenzoic acid or derivatives organic disulfide hydrocarbon derivative benzenoid primary aliphatic amine organic nitrogen compound organooxygen compound

Showing information for DMID02206170