| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:10 UTC |
|---|
| Update Date | 2025-03-25 00:54:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206181 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H15N7O2S2 |
|---|
| Molecular Mass | 305.0729 |
|---|
| SMILES | NC(CCSCc1cc(N)nc(N)n1)=NS(N)(=O)=O |
|---|
| InChI Key | OQFYOZBVCVYYRP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amidinesazacyclic compoundsdialkylthioethersheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundsprimary aminessulfenyl compounds |
|---|
| Substituents | organic sulfuric acid or derivativessulfenyl compoundaromatic heteromonocyclic compoundazacycledialkylthioetherheteroaromatic compoundamidineorganosulfur compoundpyrimidineorganic oxideorganic oxygen compoundthioetherorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamamine |
|---|
