| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:11 UTC |
|---|
| Update Date | 2025-03-25 00:54:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206224 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H26N2O3 |
|---|
| Molecular Mass | 354.1943 |
|---|
| SMILES | NC(CCN1CCC(C(O)(c2ccccc2)c2ccccc2)C1)C(=O)O |
|---|
| InChI Key | OLSJLHKYBJERIW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-aminoalcoholsalpha amino acidsamino acidsamino fatty acidsaromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acidsfatty acylshydrocarbon derivativeshydroxy fatty acidsmonoalkylaminesmonocarboxylic acids and derivativesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundstertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholfatty acyldiphenylmethanecarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acidalpha-amino acid or derivativescarboxylic acid derivativeorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydroxy fatty acidpyrrolidinetertiary amineorganoheterocyclic compoundalcohol1,3-aminoalcoholazacyclen-alkylpyrrolidinetertiary aliphatic amineamino fatty acidtertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundamineorganooxygen compound |
|---|
