| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:19 UTC |
|---|
| Update Date | 2025-03-25 00:54:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206511 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H2F4O6S |
|---|
| Molecular Mass | 253.9508 |
|---|
| SMILES | O=C(O)C(F)(F)C(=O)C(F)(F)S(=O)(=O)O |
|---|
| InChI Key | ARGUXLWVWQBOHH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | halogenated fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalpha-halocarboxylic acidsalpha-haloketonesbeta-hydroxy ketonesbeta-keto acids and derivativescarboxylic acidsfatty acylshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganosulfonic acidsshort-chain keto acids and derivativessulfonylsthia fatty acids |
|---|
| Substituents | alpha-halocarboxylic acid or derivativesbeta-hydroxy ketonealiphatic acyclic compoundorganosulfonic acid or derivativescarbonyl groupcarboxylic acidorganosulfonic acidshort-chain keto acidalpha-halocarboxylic acidorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundbeta-keto acidketoneorganic oxidealpha-haloketonealkyl halidehalogenated fatty acidalkyl fluorideorganofluoridemonocarboxylic acid or derivativesthia fatty acidsulfonylorganic oxygen compoundorganic sulfonic acid or derivativesketo acidhydrocarbon derivativeorganooxygen compound |
|---|
