| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:20 UTC |
|---|
| Update Date | 2025-03-25 00:54:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206559 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11N5O4 |
|---|
| Molecular Mass | 265.0811 |
|---|
| SMILES | O=C(O)C(=O)CCCNc1nc2nc[nH]c2c(=O)[nH]1 |
|---|
| InChI Key | WRIBQDQEDHSLCQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativesamino acidsazacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundspurines and purine derivativespyrimidonessecondary alkylarylamines |
|---|
| Substituents | carbonyl grouplactamcarboxylic acidamino acid or derivativesamino acidpyrimidonealpha-hydroxy ketonecarboxylic acid derivativepyrimidineketoneorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundalpha-keto acidorganopnictogen compoundazoleazacycleheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic aminemonocarboxylic acid or derivativesorganic oxygen compoundketo acidhypoxanthinehydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|
