| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:21 UTC |
|---|
| Update Date | 2025-03-25 00:54:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206586 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H18O15P2 |
|---|
| Molecular Mass | 428.0121 |
|---|
| SMILES | O=C(O)C(COP(=O)(O)O)OP(=O)(O)OCC1OC(O)C(O)C(O)C1O |
|---|
| InChI Key | FXZLVXWUAHBONM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdialkyl phosphateshemiacetalshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcoholssugar acids and derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acidcarboxylic acid derivativeorganic oxideglyceric_acidaliphatic heteromonocyclic compoundhemiacetaloxaneorganoheterocyclic compoundalcoholoxacycledialkyl phosphatemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatesecondary alcoholhexose phosphatehydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
