| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:21 UTC |
|---|
| Update Date | 2025-03-25 00:54:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206588 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16O10 |
|---|
| Molecular Mass | 296.0743 |
|---|
| SMILES | O=C(O)C(CO)OC1C(O)CC(O)(C(=O)O)OC1CO |
|---|
| InChI Key | WWVMKLVUMDKWQZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl ethersdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssugar acids and derivatives |
|---|
| Substituents | carbonyl groupethercarboxylic acidalpha-hydroxy acidcarboxylic acid derivativedialkyl etherbeta-hydroxy acidorganic oxideglyceric_acidaliphatic heteromonocyclic compoundhemiacetaloxaneprimary alcoholalcoholpyran carboxylic acid or derivativeshydroxy acidoxacycleorganic oxygen compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|
