| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:21 UTC |
|---|
| Update Date | 2025-03-25 00:54:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206600 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H14O12P2 |
|---|
| Molecular Mass | 351.996 |
|---|
| SMILES | O=C(O)C1(O)CC(O)C(COP(=O)(O)OP(=O)(O)O)C1O |
|---|
| InChI Key | BPSIHFYJHDEDBF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organic oxoanionic compounds |
|---|
| Subclass | organic pyrophosphates |
|---|
| Direct Parent | organic pyrophosphates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclitols and derivativescyclopentanolshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidestertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidalpha-hydroxy acidcyclitol or derivativeshydroxy acidcyclic alcoholcarboxylic acid derivativeorganic pyrophosphatecyclopentanolbeta-hydroxy acidtertiary alcoholorganic oxidemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatesecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|