| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:23 UTC |
|---|
| Update Date | 2025-03-25 00:54:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206680 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9ClNO5P |
|---|
| Molecular Mass | 264.9907 |
|---|
| SMILES | O=C(COP(=O)(O)O)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | ZJWJUOPKRNLFFT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundscarboxylic acids and derivativeschlorobenzeneshydrocarbon derivativesmonoalkyl phosphatesn-arylamidesorganic oxidesorganochloridesorganopnictogen compoundsphosphoethanolaminessecondary carboxylic acid amides |
|---|
| Substituents | carbonyl grouporganochloriden-arylamidecarboxylic acid derivativeorganohalogen compoundphosphoethanolamineorganic oxideorganonitrogen compoundorganopnictogen compoundaryl chloridechlorobenzenecarboxamide grouparyl halidearomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
