| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:25 UTC |
|---|
| Update Date | 2025-03-25 00:54:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206741 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12O5 |
|---|
| Molecular Mass | 224.0685 |
|---|
| SMILES | O=C(CO)C(O)C=Cc1ccc(O)c(O)c1 |
|---|
| InChI Key | ONDPWCCVUCZZSD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamyl alcohols |
|---|
| Subclass | cinnamyl alcohols |
|---|
| Direct Parent | cinnamyl alcohols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacyloinsalpha-hydroxy ketonesbenzene and substituted derivativesfatty alcoholshydrocarbon derivativesmonosaccharidesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholfatty acylmonocyclic benzene moietycarbonyl group1-hydroxy-2-unsubstituted benzenoidmonosaccharidecinnamyl alcohol1-hydroxy-4-unsubstituted benzenoidalpha-hydroxy ketoneketonearomatic homomonocyclic compoundsaccharideorganic oxideorganic oxygen compoundfatty alcoholacyloinsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|