| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:25 UTC |
|---|
| Update Date | 2025-03-25 00:54:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206744 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11O6P |
|---|
| Molecular Mass | 246.0293 |
|---|
| SMILES | O=C(CO)COP(=O)(O)Oc1ccccc1 |
|---|
| InChI Key | FSBYHQSAGOVUEZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxy compounds |
|---|
| Direct Parent | phenoxy compounds |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalpha-hydroxy ketonesglycerone and derivativeshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxides |
|---|
| Substituents | alcoholcarbonyl groupmonosaccharidealpha-hydroxy ketoneketonearomatic homomonocyclic compoundsaccharideorganic oxideorganic oxygen compoundglycerone or derivativesphosphoric acid estermonoalkyl phosphatehydrocarbon derivativephenoxy compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|