| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:25 UTC |
|---|
| Update Date | 2025-03-25 00:54:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206770 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C29H22N2O4 |
|---|
| Molecular Mass | 462.158 |
|---|
| SMILES | O=C(Nc1ccc(O)cc1)c1[nH]c(-c2ccc(O)cc2)c(-c2ccc(O)cc2)c1-c1ccccc1 |
|---|
| InChI Key | QIPVIWKEYDEKJU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | aromatic anilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2-heteroaryl carboxamidesazacyclic compoundsbenzene and substituted derivativescarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrrole carboxamidessecondary carboxylic acid amides |
|---|
| Substituents | aromatic heteromonocyclic compoundazacycleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidcarboxamide groupcarboxylic acid derivative2-heteroaryl carboxamidesecondary carboxylic acid amidearomatic anilideorganic oxideorganic oxygen compoundpyrrole-2-carboxylic acid or derivativespyrroleorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativepyrrole-2-carboxamideorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
