| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:28 UTC |
|---|
| Update Date | 2025-03-25 00:54:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206887 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12O13P2 |
|---|
| Molecular Mass | 353.9753 |
|---|
| SMILES | O=C(O)C1OC(O)(COP(=O)(O)O)C(OP(=O)(O)O)C1O |
|---|
| InChI Key | WSXBAVIJUTYEIR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshemiacetalshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl groupcarboxylic acidpentose phosphatepentose-5-phosphatecarboxylic acid derivativebeta-hydroxy acidorganic oxidealiphatic heteromonocyclic compoundhemiacetalorganoheterocyclic compoundalcoholtetrahydrofuranhydroxy acidoxacyclemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
