| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:32 UTC |
|---|
| Update Date | 2025-03-25 00:54:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207019 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18O7 |
|---|
| Molecular Mass | 334.1053 |
|---|
| SMILES | O=C(O)C1C(O)C(O)C(Oc2ccc3ccccc3c2)C(O)C1O |
|---|
| InChI Key | SUUFCZPSNWOGBL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalenes |
|---|
| Direct Parent | naphthalenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclitols and derivativescyclohexanolshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenol ethers |
|---|
| Substituents | alcoholphenol ethercarbonyl groupethercarboxylic acidcyclohexanolcyclitol or derivativesaromatic homopolycyclic compoundhydroxy acidcyclic alcoholalkyl aryl ethercarboxylic acid derivativebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
