| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:32 UTC |
|---|
| Update Date | 2025-03-25 00:54:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207021 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10O8S |
|---|
| Molecular Mass | 242.0096 |
|---|
| SMILES | O=C(O)C1C(O)C(O)C(CO)OS1(=O)=O |
|---|
| InChI Key | FPVUDPQTMPYKMS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | oxathianes |
|---|
| Subclass | delta sultones |
|---|
| Direct Parent | delta sultones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganosulfonic acid estersoxacyclic compoundsprimary alcoholssecondary alcoholssulfonic acid esters |
|---|
| Substituents | alcoholdelta-sultoneorganosulfonic acid or derivativescarbonyl groupcarboxylic acidhydroxy acidcarboxylic acid derivativeorganosulfonic acid estersulfonic acid esteroxacyclebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivativesaliphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeprimary alcoholorganooxygen compound |
|---|