| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:35 UTC |
|---|
| Update Date | 2025-03-25 00:54:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207115 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O6 |
|---|
| Molecular Mass | 238.0477 |
|---|
| SMILES | O=C(O)C1Cc2cc(C(O)C(=O)O)ccc2O1 |
|---|
| InChI Key | QTAFMSCXBWVYLI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | coumarans |
|---|
| Subclass | coumarans |
|---|
| Direct Parent | coumarans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha hydroxy acids and derivativesaromatic alcoholsbenzenoidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholcarbonyl groupethercarboxylic acidalpha-hydroxy acidhydroxy acidalkyl aryl ethercarboxylic acid derivativeoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidcoumaranorganooxygen compound |
|---|