DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 15:02:37 UTC
Update Date	2025-03-25 00:54:34 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID02207192
Frequency	0.5
Structure
Chemical Formula	C₁₂H₁₅N₄O₁₀P
Molecular Mass	406.0526
SMILES	Nc1nc2c(O)cc(C(=O)O)nc2n1C1OC(COP(=O)(O)O)C(O)C1O
InChI Key	JYUOIZUYYVCCSS-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic oxygen compounds
Class	organooxygen compounds
Subclass	carbohydrates and carbohydrate conjugates
Direct Parent	pentose phosphates
Geometric Descriptor	aromatic heteropolycyclic compounds
Alternative Parents	1,2-diols 2-halopyridines amino acids azacyclic compounds carboxylic acids heteroaromatic compounds hydrocarbon derivatives hydroxypyridines imidazoles imidazopyridines monoalkyl phosphates monocarboxylic acids and derivatives monosaccharides n-substituted imidazoles organic oxides organopnictogen compounds oxacyclic compounds polyhalopyridines primary amines pyridine-2-carboxylic acids secondary alcohols tetrahydrofurans
Substituents	pyridine carboxylic acid or derivatives carboxylic acid pentose phosphate amino acid or derivatives amino acid polyhalopyridine pentose-5-phosphate imidazopyridine carboxylic acid derivative organic oxide pyridine-2-carboxylic acid aromatic heteropolycyclic compound imidazole organonitrogen compound organopnictogen compound 2-halopyridine organoheterocyclic compound azole 1,2-diol n-substituted imidazole alcohol azacycle tetrahydrofuran heteroaromatic compound hydroxypyridine oxacycle monocarboxylic acid or derivatives pyridine phosphoric acid ester monoalkyl phosphate pyridine carboxylic acid secondary alcohol hydrocarbon derivative primary amine organic nitrogen compound organic phosphoric acid derivative amine alkyl phosphate

Showing information for DMID02207192