| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:37 UTC |
|---|
| Update Date | 2025-03-25 00:54:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207216 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H20N8O7 |
|---|
| Molecular Mass | 484.1455 |
|---|
| SMILES | Nc1nc(=O)c2nc(CNc3ccc(C(=O)NC(=O)NC(CCC(=O)O)C(=O)O)cc3)cnc2[nH]1 |
|---|
| InChI Key | DIUGCMWIJFVBQE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsazacyclic compoundsbenzoic acids and derivativesbenzoyl derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesn-carbamoyl-alpha amino acidsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsphenylalkylaminesprimary aminespterins and derivativespyrazinespyrimidonessecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidamino acidbenzoylpyrimidonepteridinepyrimidineorganic oxidearomatic heteropolycyclic compoundn-carbamoyl-alpha-amino acid or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundvinylogous amidepterincarbonic acid derivativeazacyclen-carbamoyl-alpha-amino acidheteroaromatic compoundbenzoic acid or derivativesglutamic acid or derivativessecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundpyrazinedicarboxylic acid or derivativesphenylalkylaminehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|