| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:39 UTC |
|---|
| Update Date | 2025-03-25 00:54:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207299 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N5O6S |
|---|
| Molecular Mass | 331.0587 |
|---|
| SMILES | Nc1nc2c(nc(SO)n2C2OC(CO)C(O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | TZWJFPRSVBSGNQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespurines and purine derivativespyrimidonesso-thioperoxolssecondary alcoholssulfenyl compoundstetrahydrofuransvinylogous amides |
|---|
| Substituents | lactammonosaccharidepyrimidoneimidazopyrimidineorganosulfur compoundpyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholvinylogous amidesulfenyl compoundazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundthioperoxoloxacycleorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativeprimary aminepurineorganic nitrogen compoundso-thioperoxolamineorganooxygen compound |
|---|