| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:40 UTC |
|---|
| Update Date | 2025-03-25 00:54:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207338 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H12N2O2S |
|---|
| Molecular Mass | 248.0619 |
|---|
| SMILES | Nc1ccc(S(=O)(=O)Cc2cccnc2)cc1 |
|---|
| InChI Key | JDGGTYLLIBVOJD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonyl compounds |
|---|
| Direct Parent | benzenesulfonyl compounds |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundsprimary aminespyridines and derivativessulfones |
|---|
| Substituents | aromatic heteromonocyclic compoundazacycleheteroaromatic compoundorganosulfur compoundorganic oxidesulfonylpyridineorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganoheterocyclic compoundsulfonebenzenesulfonyl group |
|---|