| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:41 UTC |
|---|
| Update Date | 2025-03-25 00:54:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207381 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14N2O3 |
|---|
| Molecular Mass | 282.1004 |
|---|
| SMILES | Nc1ccccc1C(=O)CC1(O)C(=O)Nc2ccccc21 |
|---|
| InChI Key | RAGSGKJQXHAJLU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaryl alkyl ketonesazacyclic compoundsbenzoyl derivativesbeta-hydroxy ketonescarboxylic acids and derivativeshydrocarbon derivativesindolesindolineslactamsorganic oxidesorganopnictogen compoundsprimary aminessecondary carboxylic acid amidestertiary alcoholsvinylogous amides |
|---|
| Substituents | beta-hydroxy ketonemonocyclic benzene moietylactamaryl alkyl ketoneamino acid or derivativesindolebenzoylcarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddihydroindoleorganoheterocyclic compoundalcoholvinylogous amideazacycleindole or derivativescarboxamide groupsecondary carboxylic acid amidetertiary alcoholhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundaminealkyl-phenylketone |
|---|
