| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:42 UTC |
|---|
| Update Date | 2025-03-25 00:54:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207390 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8N2O5S |
|---|
| Molecular Mass | 232.0154 |
|---|
| SMILES | Nc1cccc(C(=O)NS(=O)(=O)O)c1O |
|---|
| InChI Key | WIHUYMRINLFQFD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-4-unsubstituted benzenoidsamino acids and derivativesbenzoic acids and derivativesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganooxygen compoundsorganopnictogen compoundsprimary aminesvinylogous acids |
|---|
| Substituents | organic sulfuric acid or derivativesamino acid or derivativesbenzoyl1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativesalicylamidearomatic homomonocyclic compoundvinylogous acidorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
