| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:43 UTC |
|---|
| Update Date | 2025-03-25 00:54:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207439 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H22N2O2 |
|---|
| Molecular Mass | 310.1681 |
|---|
| SMILES | Nc1ccc(C(=O)N2CCC(C(O)c3ccccc3)CC2)cc1 |
|---|
| InChI Key | WVLKSTZKCDMDFY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | n-acylpiperidines |
|---|
| Direct Parent | n-benzoylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-benzoylpiperidinesamino acids and derivativesaromatic alcoholsazacyclic compoundsbenzamidescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsprimary aminessecondary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moiety1-benzoylpiperidinearomatic heteromonocyclic compoundamino acid or derivativesbenzoylcarboxylic acid derivativebenzamideorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundn-benzoylpiperidinealcoholazacyclebenzoic acid or derivativescarboxamide grouporganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
