| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:44 UTC |
|---|
| Update Date | 2025-03-25 00:54:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207484 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N3O6P |
|---|
| Molecular Mass | 289.0464 |
|---|
| SMILES | Nc1ccn(C2C3CC(O)C2OP(=O)(O)O3)c(=O)n1 |
|---|
| InChI Key | SWOOEJGIHNIHAZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | cyclopentyl nucleosides |
|---|
| Direct Parent | cyclopentyl nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclic alcohols and derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundsprimary aminespyrimidonessecondary alcohols |
|---|
| Substituents | alcoholcarbonic acid derivativeazacycleheteroaromatic compoundpyrimidonecyclic alcoholpyrimidineoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamorganic phosphoric acid derivativeamineorganoheterocyclic compoundorganooxygen compoundcyclopentyl nucleoside |
|---|
