| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:44 UTC |
|---|
| Update Date | 2025-03-25 00:54:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207496 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8F2NO3P |
|---|
| Molecular Mass | 223.021 |
|---|
| SMILES | Nc1ccccc1C(F)(F)P(=O)(O)O |
|---|
| InChI Key | DERCNBQSBUEMDH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl fluorideshydrocarbon derivativesorganic oxidesorganic phosphonic acids and derivativesorganofluoridesorganophosphorus compoundsorganopnictogen compoundsprimary amines |
|---|
| Substituents | monocyclic benzene moietyalkyl fluorideorganofluorideorganohalogen compoundaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundalkyl halidehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganophosphonic acid derivative |
|---|