| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:44 UTC |
|---|
| Update Date | 2025-03-25 00:54:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207497 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18N2O9S |
|---|
| Molecular Mass | 378.0733 |
|---|
| SMILES | Nc1ccccc1C(=O)NC1C(O)OC(COS(=O)(=O)O)C(O)C1O |
|---|
| InChI Key | JGADQFIIDOQBED-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl sulfatesamino acids and derivativesbenzamidesbenzoyl derivativescarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary aminessecondary alcoholssecondary carboxylic acid amidessulfuric acid monoestersvinylogous amides |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoesteraromatic heteromonocyclic compoundamino acid or derivativesbenzoylmonosaccharidecarboxylic acid derivativebenzamiden-acyl-alpha-hexosamineorganic oxidealkyl sulfateorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compound1,2-diolalcoholvinylogous amideorganic sulfuric acid or derivativesbenzoic acid or derivativescarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidesecondary alcoholsulfate-esterhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundsulfuric acid esteramine |
|---|