| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:45 UTC |
|---|
| Update Date | 2025-03-25 00:54:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207513 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15N3O7 |
|---|
| Molecular Mass | 313.091 |
|---|
| SMILES | Nc1ccn(C2OC(CO)C3C(O)C(C(=O)O)OC32)c(=O)n1 |
|---|
| InChI Key | LVXXBBGQMQYQNN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furofurans |
|---|
| Subclass | furofurans |
|---|
| Direct Parent | furofurans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl ethersheteroaromatic compoundshydrocarbon derivativesimidolactamsmonocarboxylic acids and derivativesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrimidonessecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl groupethercarboxylic acidamino acid or derivativesamino acidmonosaccharidepyrimidonecarboxylic acid derivativedialkyl etherpyrimidinebeta-hydroxy acidsaccharideorganic oxidearomatic heteropolycyclic compoundfurofuranorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundhydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
