| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:45 UTC |
|---|
| Update Date | 2025-03-25 00:54:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207523 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13BrN3O7P |
|---|
| Molecular Mass | 384.9674 |
|---|
| SMILES | Nc1ccn(C2OC(COP(=O)(O)O)C(O)C2Br)c(=O)n1 |
|---|
| InChI Key | PRVRWTAGZYZRGJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleotides |
|---|
| Subclass | pyrimidine deoxyribonucleotides |
|---|
| Direct Parent | pyrimidine 2'-deoxyribonucleoside monophosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl bromidesazacyclic compoundsbromohydrinsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganobromidesorganopnictogen compoundsoxacyclic compoundspentose phosphatesprimary aminespyrimidonessecondary alcoholstetrahydrofurans |
|---|
| Substituents | aromatic heteromonocyclic compoundpentose phosphatemonosaccharidepentose-5-phosphatepyrimidoneorganohalogen compoundpyrimidinepyrimidine 2'-deoxyribonucleoside monophosphatesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundalkyl halideimidolactamorganoheterocyclic compoundalcoholcarbonic acid derivativeazacycletetrahydrofuranhalohydrinheteroaromatic compoundalkyl bromideoxacycleorganic oxygen compoundbromohydrinphosphoric acid estermonoalkyl phosphatesecondary alcoholorganobromidehydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|