| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:51 UTC |
|---|
| Update Date | 2025-03-25 00:54:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207753 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H6F3N5O2S |
|---|
| Molecular Mass | 257.0194 |
|---|
| SMILES | Nc1ncnc(N)c1NS(=O)(=O)C(F)(F)F |
|---|
| InChI Key | TVFSAHGRTQDXTC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesaminosulfonyl compoundsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic oxidesorganic sulfonamidesorganofluoridesorganopnictogen compoundsorganosulfonamidesprimary aminestrihalomethanes |
|---|
| Substituents | organosulfonic acid or derivativesaromatic heteromonocyclic compoundorganosulfur compoundorganohalogen compoundpyrimidineorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundalkyl halideimidolactamhalomethanetrihalomethaneazacycleaminosulfonyl compoundalkyl fluorideorganofluorideheteroaromatic compoundsulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeprimary amineorganic nitrogen compoundorganic sulfonic acid amideamine |
|---|