| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:51 UTC |
|---|
| Update Date | 2025-03-25 00:54:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207760 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14N4O4 |
|---|
| Molecular Mass | 242.1015 |
|---|
| SMILES | Nc1ncnc(C2OC(CO)C(O)C2O)c1N |
|---|
| InChI Key | NZIAKSFDDYEFFG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativesimidolactamsmonosaccharidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminessecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholetheraromatic heteromonocyclic compoundazacycletetrahydrofuranheteroaromatic compoundmonosaccharidedialkyl etherpyrimidineoxacyclesaccharideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundprimary alcoholimidolactamamineorganooxygen compound |
|---|
