| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:52 UTC |
|---|
| Update Date | 2025-03-25 00:54:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02207796 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H13N5O4 |
|---|
| Molecular Mass | 279.0968 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC2C(O)C(CO)C2O1 |
|---|
| InChI Key | VSLLSUUWDZUUAR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxepanes1,3-dioxolanesazacyclic compoundscyclic alcohols and derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrimidines and pyrimidine derivativessecondary alcohols |
|---|
| Substituents | 1,3-dioxepanemeta-dioxolanepyrimidinearomatic heteropolycyclic compoundimidazolecyclobutanolorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamazolen-substituted imidazolealcoholazacycleheteroaromatic compounddioxepaneoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
