DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 15:02:57 UTC
Update Date	2025-03-25 00:54:41 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID02208013
Frequency	0.5
Structure
Chemical Formula	C₁₈H₃₀N₄O₃
Molecular Mass	350.2318
SMILES	CC(C)CC(N)C(CCC(N)=O)NC(=O)C(N)Cc1ccc(O)cc1
InChI Key	LTDYZAXAOUKWJR-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	peptidomimetics
Subclass	hybrid peptides
Direct Parent	hybrid peptides
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	1-hydroxy-2-unsubstituted benzenoids alpha amino acid amides alpha amino acids amphetamines and derivatives benzene and substituted derivatives carbonyl compounds carboxylic acids and derivatives delta amino acids and derivatives fatty amides gamma amino acids and derivatives hydrocarbon derivatives monoalkylamines organic oxides organonitrogen compounds organopnictogen compounds phenylalanine and derivatives primary carboxylic acid amides secondary carboxylic acid amides tyrosine and derivatives
Substituents	primary carboxylic acid amide fatty acyl monocyclic benzene moiety carbonyl group gamma amino acid or derivatives fatty amide 1-hydroxy-2-unsubstituted benzenoid alpha-amino acid or derivatives carboxylic acid derivative organic oxide organonitrogen compound alpha-amino acid organopnictogen compound delta amino acid or derivatives amphetamine or derivatives tyrosine or derivatives alpha-amino acid amide carboxamide group aromatic homomonocyclic compound secondary carboxylic acid amide phenylalanine or derivatives organic oxygen compound hybrid peptide phenol hydrocarbon derivative benzenoid primary aliphatic amine organic nitrogen compound organooxygen compound

Showing information for DMID02208013