| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:58 UTC |
|---|
| Update Date | 2025-03-25 00:54:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02208030 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H19NO4 |
|---|
| Molecular Mass | 217.1314 |
|---|
| SMILES | CC(C)CC(N)C(=O)OCC(C)C(=O)O |
|---|
| InChI Key | ZOZAIHSRTNBJHY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | peptidomimetics |
|---|
| Subclass | depsipeptides |
|---|
| Direct Parent | depsipeptides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acid estersalpha amino acidscarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesfatty acid estershydrocarbon derivativesleucine and derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | fatty acylaliphatic acyclic compounddepsipeptidecarbonyl groupcarboxylic acidalpha-amino acid esteralpha-amino acid or derivativescarboxylic acid derivativefatty acid esterorganic oxideorganic oxygen compoundcarboxylic acid esterleucine or derivativesorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
