| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:03 UTC |
|---|
| Update Date | 2025-03-25 00:54:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02208218 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H30 |
|---|
| Molecular Mass | 270.2348 |
|---|
| SMILES | CC(C)c1ccc2c(c1)C1(C)CCCC(C)(C)C1CC2 |
|---|
| InChI Key | RDLPKDPGXJIPNR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | diterpenoids |
|---|
| Direct Parent | diterpenoids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | phenanthrenes and derivativespolycyclic hydrocarbonssaturated hydrocarbonstetralins |
|---|
| Substituents | tetralinsaturated hydrocarbonphenanthreneabietane diterpenoidaromatic homopolycyclic compoundbenzenoidpolycyclic hydrocarbonditerpenoidhydrocarbon |
|---|
