| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:03 UTC |
|---|
| Update Date | 2025-03-25 00:54:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02208231 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H20O3 |
|---|
| Molecular Mass | 296.1412 |
|---|
| SMILES | CC(C)c1ccc(C(=O)c2ccc(C(C)C(=O)O)cc2)cc1 |
|---|
| InChI Key | SDKGBSBTDIBAHV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aromatic monoterpenoidsaryl ketonesaryl-phenylketonesbenzoyl derivativescarboxylic acidscumenesdiphenylmethaneshydrocarbon derivativesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxidesphenylpropanesphenylpropanoic acids |
|---|
| Substituents | diphenylmethanemonoterpenoidcarbonyl groupmonocyclic monoterpenoidcarboxylic acidbenzoylp-cymenecarboxylic acid derivativebenzophenoneketonephenylpropaneorganic oxide2-phenylpropanoic-acidcumenearyl-phenylketonearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganooxygen compoundaromatic monoterpenoidaryl ketone |
|---|
