| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:03 UTC |
|---|
| Update Date | 2025-03-25 00:54:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02208252 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C30H50O9 |
|---|
| Molecular Mass | 554.3455 |
|---|
| SMILES | CC(CCC(=O)O)C1CCC2C3C(O)CC4CC(OC5OC(C)C(O)C(O)C5O)CCC4(C)C3C(O)CC12C |
|---|
| InChI Key | KWSFZLHQECGIDZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | steroidal glycosides |
|---|
| Direct Parent | steroidal glycosides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 11-hydroxysteroids7-hydroxysteroidsacetalsbile acids, alcohols and derivativescarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidsteroidal glycosidemonosaccharidecarboxylic acid derivativebile acid, alcohol, or derivativesaliphatic heteropolycyclic compoundsaccharideorganic oxideacetaloxaneorganoheterocyclic compoundalcoholhydroxysteroidcyclic alcohol7-hydroxysteroidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivative11-hydroxysteroidorganooxygen compound |
|---|