| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:08 UTC |
|---|
| Update Date | 2025-03-25 00:54:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02208437 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16Cl2O3 |
|---|
| Molecular Mass | 290.0476 |
|---|
| SMILES | CC(C)COC(=O)C(C)Oc1ccc(Cl)cc1Cl |
|---|
| InChI Key | BQVQYSNGMWIMPH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | 2-phenoxypropionic acid esters |
|---|
| Direct Parent | 2-phenoxypropionic acid esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaryl chloridescarbonyl compoundscarboxylic acid estersdichlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesphenol ethersphenoxy compoundsphenoxyacetic acid derivatives |
|---|
| Substituents | phenol etherphenoxyacetatecarbonyl groupetherorganochloridealkyl aryl ethercarboxylic acid derivativeorganohalogen compound1,3-dichlorobenzeneorganic oxide2-phenoxypropionic acid esteraryl chloridechlorobenzenearyl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativehalobenzenephenoxy compoundorganooxygen compound |
|---|