| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:08 UTC |
|---|
| Update Date | 2025-03-25 00:54:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02208446 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H19N7O |
|---|
| Molecular Mass | 289.1651 |
|---|
| SMILES | CC(C)N1CCN(c2cnc3nc(N)[nH]c(=O)c3n2)CC1 |
|---|
| InChI Key | APZKZYNXHJFXLG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aminopyrazinesazacyclic compoundsdialkylarylaminesheteroaromatic compoundshydrocarbon derivativesimidolactamslactamsn-alkylpiperazinesn-arylpiperazinesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrimidonestrialkylamines |
|---|
| Substituents | lactampyrimidonepyrimidineorganic oxidepiperazinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddialkylarylamineimidolactamtertiary amineaminopyrazinepterinazacyclen-alkylpiperazineheteroaromatic compoundtertiary aliphatic amineorganic oxygen compoundpyrazine1,4-diazinanehydrocarbon derivativeprimary amineorganic nitrogen compoundaminen-arylpiperazineorganooxygen compound |
|---|
