| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:12 UTC |
|---|
| Update Date | 2025-03-25 00:54:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02208608 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H27NO3 |
|---|
| Molecular Mass | 329.1991 |
|---|
| SMILES | CC(C)(C)c1cc(C(=O)NCc2ccco2)cc(C(C)(C)C)c1O |
|---|
| InChI Key | YTIUQBYHPIJTDH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | benzoyl derivativescarboxylic acids and derivativesfuransheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsphenolsphenylpropanessecondary carboxylic acid amides |
|---|
| Substituents | furanaromatic heteromonocyclic compoundheteroaromatic compoundbenzoylcarboxamide groupcarboxylic acid derivativebenzamidephenylpropaneoxacyclesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|