| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:15 UTC |
|---|
| Update Date | 2025-03-25 00:54:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02208733 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10O7 |
|---|
| Molecular Mass | 218.0427 |
|---|
| SMILES | CC(C(=O)O)C(=O)C(CC(=O)O)C(=O)O |
|---|
| InChI Key | NQXPEVJVTYLHCH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsbeta-hydroxy ketonesbeta-keto acids and derivativescarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesorganic oxides |
|---|
| Substituents | beta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupcarboxylic acidtricarboxylic acid or derivativesbeta-keto acidgamma-keto acidketoneorganic oxideorganic oxygen compoundketo acidhydrocarbon derivative1,3-dicarbonyl compoundorganooxygen compound |
|---|