| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:16 UTC |
|---|
| Update Date | 2025-03-25 00:54:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02208766 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O4 |
|---|
| Molecular Mass | 206.0579 |
|---|
| SMILES | CC(=O)c1ccc2c(c1)OC(C(=O)O)C2 |
|---|
| InChI Key | UUELGYFIRBRWIR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | acetophenones |
|---|
| Direct Parent | acetophenones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaryl alkyl ketonesbenzenoidscarboxylic acidscoumaranshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compounds |
|---|
| Substituents | carbonyl groupethercarboxylic acidaryl alkyl ketonealkyl aryl ethercarboxylic acid derivativeketoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundacetophenonehydrocarbon derivativeorganoheterocyclic compoundcoumaranorganooxygen compoundaryl ketone |
|---|
