| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:17 UTC |
|---|
| Update Date | 2025-03-25 00:54:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02208779 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H19N2O3S+ |
|---|
| Molecular Mass | 235.1111 |
|---|
| SMILES | CC(C(=O)N1CCCS1(=O)=O)[N+](C)(C)C |
|---|
| InChI Key | GBZIBDYAINDHET-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | aminesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesgamma sultamshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsorganosulfonic acids and derivativestetraalkylammonium salts |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl grouptetraalkylammonium saltazacyclequaternary ammonium saltgamma-sultamorganic oxideorganic oxygen compoundorganic sulfonic acid or derivativesaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamineorganoheterocyclic compoundorganooxygen compound |
|---|