| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:33 UTC |
|---|
| Update Date | 2025-03-25 00:54:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02209439 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16O |
|---|
| Molecular Mass | 188.1201 |
|---|
| SMILES | CC1=CC(C)(C)c2cc(O)c(C)cc21 |
|---|
| InChI Key | ZHSOUMYOJKNAGL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | indenes and isoindenes |
|---|
| Subclass | indenes and isoindenes |
|---|
| Direct Parent | indenes and isoindenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidshydrocarbon derivativesorganooxygen compounds |
|---|
| Substituents | indeneorganic oxygen compound1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundhydrocarbon derivativeorganooxygen compound |
|---|