| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:35 UTC |
|---|
| Update Date | 2025-03-25 00:54:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02209516 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C27H38O2 |
|---|
| Molecular Mass | 394.2872 |
|---|
| SMILES | CC12CCC3C(CCC4C(C)(C)C(O)CCC34C)C1=CCC2c1ccc(O)cc1 |
|---|
| InChI Key | RGMWEHLPEMLULL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | hydroxysteroids |
|---|
| Direct Parent | 3-hydroxysteroids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativescyclic alcohols and derivativeshydrocarbon derivativessecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moiety3-hydroxysteroid1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundcyclic alcoholorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
