| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:39 UTC |
|---|
| Update Date | 2025-03-25 00:54:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02209660 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H13NO4 |
|---|
| Molecular Mass | 235.0845 |
|---|
| SMILES | CC(O)C(=O)N1Cc2ccccc2C1C(=O)O |
|---|
| InChI Key | DYMYPGLYMBZIMV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | bicyclic amino acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acidshydrocarbon derivativesisoindolesisoindolinesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | bicyclic amino acidcarbonyl groupcarboxylic acidalpha-amino acid or derivativescarboxylic acid derivativeorganic oxideisoindolinearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundalcoholazacycleisoindolecarboxamide groupmonocarboxylic acid or derivativesisoindole or derivativessecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|