| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:50 UTC |
|---|
| Update Date | 2025-03-25 00:55:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02210123 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H17N2O10P |
|---|
| Molecular Mass | 356.0621 |
|---|
| SMILES | CC(O)C1NC(=O)N(C2OC(COP(=O)(O)O)C(O)C2O)C1=O |
|---|
| InChI Key | CHSBUIFWPRAQRT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | glycinamide ribonucleotides |
|---|
| Subclass | glycinamide ribonucleotides |
|---|
| Direct Parent | glycinamide ribonucleotides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdicarboximideshydantoinshydrocarbon derivativesimidazolidinonesmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatessecondary alcoholstetrahydrofurans |
|---|
| Substituents | imidazolidinecarbonyl grouppentose phosphatemonosaccharidepentose-5-phosphateglycinamide-ribonucleotidealpha-amino acid or derivativescarboxylic acid derivativeimidazolidinonesaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximideorganoheterocyclic compoundalcoholcarbonic acid derivativeazacycletetrahydrofuranoxacycleorganic oxygen compoundphosphoric acid esterhydantoinmonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
