| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:51 UTC |
|---|
| Update Date | 2025-03-25 00:55:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02210163 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H15N3O5 |
|---|
| Molecular Mass | 245.1012 |
|---|
| SMILES | CC(O)C(O)C1NC(=O)C(CC(N)=O)NC1=O |
|---|
| InChI Key | RDRKORKBUYYEJD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols2,5-dioxopiperazinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidecarbonyl grouplactam2,5-dioxopiperazineorganic oxidedioxopiperazinepiperazinealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compound1,2-diolalcoholazacyclecarboxamide groupsecondary carboxylic acid amideorganic oxygen compound1,4-diazinanesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
