| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:03:58 UTC |
|---|
| Update Date | 2025-03-25 00:55:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02210456 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C25H39N4O20P |
|---|
| Molecular Mass | 746.1895 |
|---|
| SMILES | CC(=O)NC1C(O)CC(OCC2OC(OP(=O)(O)OCC3OC(n4ccc(N)nc4=O)C(O)C3O)C(O)C2O)(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | YJAQTZXQEPNIJQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acidsazacyclic compoundsc-glucuronidescarbonyl compoundscarboxylic acidsdialkyl phosphatesheteroaromatic compoundshydrocarbon derivativesimidolactamsketalsmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespentose phosphatesprimary alcoholsprimary aminespyran carboxylic acidspyrimidine ribonucleoside monophosphatespyrimidonessecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundpentose phosphateamino acid or derivativesamino acidmonosaccharidepentose-5-phosphatepyrimidonecarboxylic acid derivativepyran carboxylic acidpyrimidineorganic oxideacetalketalorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholimidolactamorganoheterocyclic compoundacetamidec-glucuronidealcoholcarbonic acid derivativepyran carboxylic acid or derivativesazacycletetrahydrofuranheteroaromatic compoundcarboxamide groupoxacyclesecondary carboxylic acid amidedialkyl phosphatepyrimidine ribonucleoside monophosphatemonocarboxylic acid or derivativesphosphoric acid esterpyransecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphate |
|---|